![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| The principal delive..> | 2019-01-16 13:51 | 563K | |
| The marching band ki..> | 2019-01-16 13:52 | 706K | |
| School Orchestra.JPG | 2019-01-16 13:52 | 724K | |
| Parents-teachers cho..> | 2019-01-16 13:52 | 612K | |
| DSC_5177.JPG | 2019-01-16 13:52 | 618K | |
| DSC_5150.JPG | 2019-01-16 13:52 | 709K | |
| DSC_1769.JPG | 2019-01-16 13:52 | 783K | |
| DSC_1642.JPG | 2019-01-16 13:52 | 589K | |
| DSC_1507.JPG | 2019-01-16 13:52 | 775K | |
| DSC_1494.JPG | 2019-01-16 13:51 | 758K | |
| A cappella group.JPG | 2019-01-16 13:52 | 620K | |
